C16H11F13O2 — CID 164682852
2-methoxy-6-[(E)-4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoronon-2-enyl]phenol (PubChem CID 164682852) has the molecular formula C16H11F13O2 and a molecular weight of 482.24 g/mol. Its IUPAC name is 2-methoxy-6-[(E)-4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoronon-2-enyl]phenol.
| Compound Name | 2-methoxy-6-[(E)-4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoronon-2-enyl]phenol |
|---|---|
| PubChem CID | 164682852 |
| Molecular Formula | C16H11F13O2 |
| Molecular Weight | 482.24 g/mol |
| Exact Mass | 482.06 |
| IUPAC Name | 2-methoxy-6-[(E)-4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoronon-2-enyl]phenol |
| SMILES | COc1cccc(C/C=C/C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1O |
| InChI | InChI=1S/C16H11F13O2/c1-31-9-6-2-4-8(10(9)30)5-3-7-11(17,18)12(19,20)13(21,22)14(23,24)15(25,26)16(27,28)29/h2-4,6-7,30H,5H2,1H3/b7-3+ |
| InChIKey | XTDUMKHNHYCITN-XVNBXDOJSA-N |
| XLogP | 6.24 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.24 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|