C15H14F3N3O — CID 164684524
2-[1-(1-azidoethoxy)-3,3,3-trifluoropropyl]naphthalene (PubChem CID 164684524) has the molecular formula C15H14F3N3O and a molecular weight of 309.29 g/mol. Its IUPAC name is 2-[1-(1-azidoethoxy)-3,3,3-trifluoropropyl]naphthalene.
| Compound Name | 2-[1-(1-azidoethoxy)-3,3,3-trifluoropropyl]naphthalene |
|---|---|
| PubChem CID | 164684524 |
| Molecular Formula | C15H14F3N3O |
| Molecular Weight | 309.29 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 2-[1-(1-azidoethoxy)-3,3,3-trifluoropropyl]naphthalene |
| SMILES | CC(N=[N+]=[N-])OC(CC(F)(F)F)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C15H14F3N3O/c1-10(20-21-19)22-14(9-15(16,17)18)13-7-6-11-4-2-3-5-12(11)8-13/h2-8,10,14H,9H2,1H3 |
| InChIKey | PFWAZKPEZRXSNS-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 57.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.29 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|