About 4-methyl-2,6-bis[4-(trifluoromethyl)phenyl]-1,4λ5-oxaphosphinine 4-oxide
4-methyl-2,6-bis[4-(trifluoromethyl)phenyl]-1,4λ5-oxaphosphinine 4-oxide (PubChem CID 164685113) has the molecular formula C19H13F6O2P
and a molecular weight of 418.27 g/mol. Its IUPAC name is 4-methyl-2,6-bis[4-(trifluoromethyl)phenyl]-1,4λ5-oxaphosphinine 4-oxide.
Molecular Properties
| Compound Name | 4-methyl-2,6-bis[4-(trifluoromethyl)phenyl]-1,4λ5-oxaphosphinine 4-oxide |
| PubChem CID | 164685113 |
| Molecular Formula | C19H13F6O2P |
| Molecular Weight | 418.27 g/mol |
| Exact Mass | 418.06 |
| IUPAC Name | 4-methyl-2,6-bis[4-(trifluoromethyl)phenyl]-1,4λ5-oxaphosphinine 4-oxide |
| SMILES | CP1(=O)C=C(c2ccc(C(F)(F)F)cc2)OC(c2ccc(C(F)(F)F)cc2)=C1 |
| InChI | InChI=1S/C19H13F6O2P/c1-28(26)10-16(12-2-6-14(7-3-12)18(20,21)22)27-17(11-28)13-4-8-15(9-5-13)19(23,24)25/h2-11H,1H3 |
| InChIKey | RCJDOPHACWLOGB-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 418.27 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-2,6-bis[4-(trifluoromethyl)phenyl]-1,4λ5-oxaphosphinine 4-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2,6-bis[4-(trifluoromethyl)phenyl]-1,4λ5-oxaphosphinine 4-oxide?
The IUPAC name of 4-methyl-2,6-bis[4-(trifluoromethyl)phenyl]-1,4λ5-oxaphosphinine 4-oxide (CID 164685113) is 4-methyl-2,6-bis[4-(trifluoromethyl)phenyl]-1,4λ5-oxaphosphinine 4-oxide.
What is the SMILES notation for 4-methyl-2,6-bis[4-(trifluoromethyl)phenyl]-1,4λ5-oxaphosphinine 4-oxide?
The canonical SMILES for 4-methyl-2,6-bis[4-(trifluoromethyl)phenyl]-1,4λ5-oxaphosphinine 4-oxide is CP1(=O)C=C(c2ccc(C(F)(F)F)cc2)OC(c2ccc(C(F)(F)F)cc2)=C1.
What is the InChIKey of 4-methyl-2,6-bis[4-(trifluoromethyl)phenyl]-1,4λ5-oxaphosphinine 4-oxide?
The InChIKey is RCJDOPHACWLOGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13F6O2P/c1-28(26)10-16(12-2-6-14(7-3-12)18(20,21)22)27-17(11-28)13-4-8-15(9-5-13)19(23,24)25/h2-11H,1H3.
What are the key properties of 4-methyl-2,6-bis[4-(trifluoromethyl)phenyl]-1,4λ5-oxaphosphinine 4-oxide?
4-methyl-2,6-bis[4-(trifluoromethyl)phenyl]-1,4λ5-oxaphosphinine 4-oxide has a molecular weight of 418.27 g/mol, XLogP of 7.04, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2,6-bis[4-(trifluoromethyl)phenyl]-1,4λ5-oxaphosphinine 4-oxide is sourced from PubChem (CID 164685113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).