C13H22O4Si — CID 164685272
dimethyl 2-methyl-2-(4-trimethylsilylbuta-2,3-dienyl)propanedioate (PubChem CID 164685272) has the molecular formula C13H22O4Si and a molecular weight of 270.40 g/mol. Its IUPAC name is dimethyl 2-methyl-2-(4-trimethylsilylbuta-2,3-dienyl)propanedioate.
| Compound Name | dimethyl 2-methyl-2-(4-trimethylsilylbuta-2,3-dienyl)propanedioate |
|---|---|
| PubChem CID | 164685272 |
| Molecular Formula | C13H22O4Si |
| Molecular Weight | 270.40 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | dimethyl 2-methyl-2-(4-trimethylsilylbuta-2,3-dienyl)propanedioate |
| SMILES | COC(=O)C(C)(CC=C=C[Si](C)(C)C)C(=O)OC |
| InChI | InChI=1S/C13H22O4Si/c1-13(11(14)16-2,12(15)17-3)9-7-8-10-18(4,5)6/h7,10H,9H2,1-6H3 |
| InChIKey | GQJGFZQZVAMIPM-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.40 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|