C20H16O3S — CID 164686107
ethyl 4-oxo-2,6-diphenylthiopyran-3-carboxylate (PubChem CID 164686107) has the molecular formula C20H16O3S and a molecular weight of 336.41 g/mol. Its IUPAC name is ethyl 4-oxo-2,6-diphenylthiopyran-3-carboxylate.
| Compound Name | ethyl 4-oxo-2,6-diphenylthiopyran-3-carboxylate |
|---|---|
| PubChem CID | 164686107 |
| Molecular Formula | C20H16O3S |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | ethyl 4-oxo-2,6-diphenylthiopyran-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)sc(-c2ccccc2)cc1=O |
| InChI | InChI=1S/C20H16O3S/c1-2-23-20(22)18-16(21)13-17(14-9-5-3-6-10-14)24-19(18)15-11-7-4-8-12-15/h3-13H,2H2,1H3 |
| InChIKey | ZDKXVPZREQFZMC-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |