C12H24Si2 — CID 164687144
(3-cyclopropyl-1-trimethylsilylpropa-1,2-dienyl)-trimethylsilane (PubChem CID 164687144) has the molecular formula C12H24Si2 and a molecular weight of 224.50 g/mol. Its IUPAC name is (3-cyclopropyl-1-trimethylsilylpropa-1,2-dienyl)-trimethylsilane.
| Compound Name | (3-cyclopropyl-1-trimethylsilylpropa-1,2-dienyl)-trimethylsilane |
|---|---|
| PubChem CID | 164687144 |
| Molecular Formula | C12H24Si2 |
| Molecular Weight | 224.50 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | (3-cyclopropyl-1-trimethylsilylpropa-1,2-dienyl)-trimethylsilane |
| SMILES | C[Si](C)(C)C(=C=CC1CC1)[Si](C)(C)C |
| InChI | InChI=1S/C12H24Si2/c1-13(2,3)12(14(4,5)6)10-9-11-7-8-11/h9,11H,7-8H2,1-6H3 |
| InChIKey | ZRAZUCXJYOWOLW-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.50 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|