C14H32Si3 — CID 5366661
trimethyl-[(E)-[3-methyl-2,2-bis(trimethylsilyl)cyclopropylidene]methyl]silane (PubChem CID 5366661) has the molecular formula C14H32Si3 and a molecular weight of 284.67 g/mol. Its IUPAC name is trimethyl-[(E)-[3-methyl-2,2-bis(trimethylsilyl)cyclopropylidene]methyl]silane.
| Compound Name | trimethyl-[(E)-[3-methyl-2,2-bis(trimethylsilyl)cyclopropylidene]methyl]silane |
|---|---|
| PubChem CID | 5366661 |
| Molecular Formula | C14H32Si3 |
| Molecular Weight | 284.67 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | trimethyl-[(E)-[3-methyl-2,2-bis(trimethylsilyl)cyclopropylidene]methyl]silane |
| SMILES | CC1/C(=C\[Si](C)(C)C)C1([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C14H32Si3/c1-12-13(11-15(2,3)4)14(12,16(5,6)7)17(8,9)10/h11-12H,1-10H3/b13-11+ |
| InChIKey | FYVUMOFEKHHLKP-ACCUITESSA-N |
| XLogP | 5.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.67 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|