C26H28N2 — CID 164687351
1-(7,7-dimethyl-4-methylideneoct-5-ynyl)-4,5-diphenylimidazole (PubChem CID 164687351) has the molecular formula C26H28N2 and a molecular weight of 368.52 g/mol. Its IUPAC name is 1-(7,7-dimethyl-4-methylideneoct-5-ynyl)-4,5-diphenylimidazole.
| Compound Name | 1-(7,7-dimethyl-4-methylideneoct-5-ynyl)-4,5-diphenylimidazole |
|---|---|
| PubChem CID | 164687351 |
| Molecular Formula | C26H28N2 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.23 |
| IUPAC Name | 1-(7,7-dimethyl-4-methylideneoct-5-ynyl)-4,5-diphenylimidazole |
| SMILES | C=C(C#CC(C)(C)C)CCCn1cnc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C26H28N2/c1-21(17-18-26(2,3)4)12-11-19-28-20-27-24(22-13-7-5-8-14-22)25(28)23-15-9-6-10-16-23/h5-10,13-16,20H,1,11-12,19H2,2-4H3 |
| InChIKey | RGGNNLDWMMHNKF-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|