C32H32N4O4 — CID 164693998
(3S,8S)-14-methyl-6-(quinolin-4-ylmethyl)-2,16-dioxa-6,9,19-triazatetracyclo[19.2.2.111,15.03,8]hexacosa-1(24),11(26),12,14,21(25),22-hexaene-10,18-dione (PubChem CID 164693998) has the molecular formula C32H32N4O4 and a molecular weight of 536.63 g/mol. Its IUPAC name is (3S,8S)-14-methyl-6-(quinolin-4-ylmethyl)-2,16-dioxa-6,9,19-triazatetracyclo[19.2.2.111,15.03,8]hexacosa-1(24),11(26),12,14,21(25),22-hexaene-10,18-dione.
| Compound Name | (3S,8S)-14-methyl-6-(quinolin-4-ylmethyl)-2,16-dioxa-6,9,19-triazatetracyclo[19.2.2.111,15.03,8]hexacosa-1(24),11(26),12,14,21(25),22-hexaene-10,18-dione |
|---|---|
| PubChem CID | 164693998 |
| Molecular Formula | C32H32N4O4 |
| Molecular Weight | 536.63 g/mol |
| Exact Mass | 536.24 |
| IUPAC Name | (3S,8S)-14-methyl-6-(quinolin-4-ylmethyl)-2,16-dioxa-6,9,19-triazatetracyclo[19.2.2.111,15.03,8]hexacosa-1(24),11(26),12,14,21(25),22-hexaene-10,18-dione |
| SMILES | Cc1ccc2cc1OCC(=O)NCc1ccc(cc1)O[C@H]1CCN(Cc3ccnc4ccccc34)C[C@@H]1NC2=O |
| InChI | InChI=1S/C32H32N4O4/c1-21-6-9-23-16-30(21)39-20-31(37)34-17-22-7-10-25(11-8-22)40-29-13-15-36(19-28(29)35-32(23)38)18-24-12-14-33-27-5-3-2-4-26(24)27/h2-12,14,16,28-29H,13,15,17-20H2,1H3,(H,34,37)(H,35,38)/t28-,29-/m0/s1 |
| InChIKey | JXBRJFANJQFTBT-VMPREFPWSA-N |
| XLogP | 4.00 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.63 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |