C35H42N4O7 — CID 164696509
(3S,7S)-13-methoxy-5-[[2-(3-morpholin-4-ylpropoxy)phenyl]methyl]-2,15-dioxa-5,8,18-triazatetracyclo[18.2.2.110,14.03,7]pentacosa-1(23),10(25),11,13,20(24),21-hexaene-9,17-dione (PubChem CID 164696509) has the molecular formula C35H42N4O7 and a molecular weight of 630.74 g/mol. Its IUPAC name is (3S,7S)-13-methoxy-5-[[2-(3-morpholin-4-ylpropoxy)phenyl]methyl]-2,15-dioxa-5,8,18-triazatetracyclo[18.2.2.110,14.03,7]pentacosa-1(23),10(25),11,13,20(24),21-hexaene-9,17-dione.
| Compound Name | (3S,7S)-13-methoxy-5-[[2-(3-morpholin-4-ylpropoxy)phenyl]methyl]-2,15-dioxa-5,8,18-triazatetracyclo[18.2.2.110,14.03,7]pentacosa-1(23),10(25),11,13,20(24),21-hexaene-9,17-dione |
|---|---|
| PubChem CID | 164696509 |
| Molecular Formula | C35H42N4O7 |
| Molecular Weight | 630.74 g/mol |
| Exact Mass | 630.31 |
| IUPAC Name | (3S,7S)-13-methoxy-5-[[2-(3-morpholin-4-ylpropoxy)phenyl]methyl]-2,15-dioxa-5,8,18-triazatetracyclo[18.2.2.110,14.03,7]pentacosa-1(23),10(25),11,13,20(24),21-hexaene-9,17-dione |
| SMILES | COc1ccc2cc1OCC(=O)NCc1ccc(cc1)O[C@H]1CN(Cc3ccccc3OCCCN3CCOCC3)C[C@@H]1NC2=O |
| InChI | InChI=1S/C35H42N4O7/c1-42-31-12-9-26-19-32(31)45-24-34(40)36-20-25-7-10-28(11-8-25)46-33-23-39(22-29(33)37-35(26)41)21-27-5-2-3-6-30(27)44-16-4-13-38-14-17-43-18-15-38/h2-3,5-12,19,29,33H,4,13-18,20-24H2,1H3,(H,36,40)(H,37,41)/t29-,33-/m0/s1 |
| InChIKey | BDCNUFASOMCFEG-ZQAZVOLISA-N |
| XLogP | 2.87 |
| TPSA | 110.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.74 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|