About [2-[(4R,5R)-4-hydroxy-7-azaspiro[4.5]decan-7-yl]-4-pyridinyl]-morpholin-4-ylmethanone
[2-[(4R,5R)-4-hydroxy-7-azaspiro[4.5]decan-7-yl]-4-pyridinyl]-morpholin-4-ylmethanone (PubChem CID 164694880) has the molecular formula C19H27N3O3
and a molecular weight of 345.44 g/mol. Its IUPAC name is [2-[(4R,5R)-4-hydroxy-7-azaspiro[4.5]decan-7-yl]-4-pyridinyl]-morpholin-4-ylmethanone.
Molecular Properties
| Compound Name | [2-[(4R,5R)-4-hydroxy-7-azaspiro[4.5]decan-7-yl]-4-pyridinyl]-morpholin-4-ylmethanone |
| PubChem CID | 164694880 |
| Molecular Formula | C19H27N3O3 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | [2-[(4R,5R)-4-hydroxy-7-azaspiro[4.5]decan-7-yl]-4-pyridinyl]-morpholin-4-ylmethanone |
| SMILES | O=C(c1ccnc(N2CCC[C@]3(CCC[C@H]3O)C2)c1)N1CCOCC1 |
| InChI | InChI=1S/C19H27N3O3/c23-16-3-1-5-19(16)6-2-8-22(14-19)17-13-15(4-7-20-17)18(24)21-9-11-25-12-10-21/h4,7,13,16,23H,1-3,5-6,8-12,14H2/t16-,19-/m1/s1 |
| InChIKey | UOWYBGGIPTYENR-VQIMIIECSA-N |
| XLogP | 1.69 |
| TPSA | 65.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-[(4R,5R)-4-hydroxy-7-azaspiro[4.5]decan-7-yl]-4-pyridinyl]-morpholin-4-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(4R,5R)-4-hydroxy-7-azaspiro[4.5]decan-7-yl]-4-pyridinyl]-morpholin-4-ylmethanone?
The IUPAC name of [2-[(4R,5R)-4-hydroxy-7-azaspiro[4.5]decan-7-yl]-4-pyridinyl]-morpholin-4-ylmethanone (CID 164694880) is [2-[(4R,5R)-4-hydroxy-7-azaspiro[4.5]decan-7-yl]-4-pyridinyl]-morpholin-4-ylmethanone.
What is the SMILES notation for [2-[(4R,5R)-4-hydroxy-7-azaspiro[4.5]decan-7-yl]-4-pyridinyl]-morpholin-4-ylmethanone?
The canonical SMILES for [2-[(4R,5R)-4-hydroxy-7-azaspiro[4.5]decan-7-yl]-4-pyridinyl]-morpholin-4-ylmethanone is O=C(c1ccnc(N2CCC[C@]3(CCC[C@H]3O)C2)c1)N1CCOCC1.
What is the InChIKey of [2-[(4R,5R)-4-hydroxy-7-azaspiro[4.5]decan-7-yl]-4-pyridinyl]-morpholin-4-ylmethanone?
The InChIKey is UOWYBGGIPTYENR-VQIMIIECSA-N. The full InChI is InChI=1S/C19H27N3O3/c23-16-3-1-5-19(16)6-2-8-22(14-19)17-13-15(4-7-20-17)18(24)21-9-11-25-12-10-21/h4,7,13,16,23H,1-3,5-6,8-12,14H2/t16-,19-/m1/s1.
What are the key properties of [2-[(4R,5R)-4-hydroxy-7-azaspiro[4.5]decan-7-yl]-4-pyridinyl]-morpholin-4-ylmethanone?
[2-[(4R,5R)-4-hydroxy-7-azaspiro[4.5]decan-7-yl]-4-pyridinyl]-morpholin-4-ylmethanone has a molecular weight of 345.44 g/mol, XLogP of 1.69, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(4R,5R)-4-hydroxy-7-azaspiro[4.5]decan-7-yl]-4-pyridinyl]-morpholin-4-ylmethanone is sourced from PubChem (CID 164694880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).