C19H30N4O4 — CID 154918505
formic acid;(4R,5R)-7-(6-methyl-2-morpholin-4-ylpyrimidin-4-yl)-7-azaspiro[4.5]decan-4-ol (PubChem CID 154918505) has the molecular formula C19H30N4O4 and a molecular weight of 378.47 g/mol. Its IUPAC name is formic acid;(4R,5R)-7-(6-methyl-2-morpholin-4-ylpyrimidin-4-yl)-7-azaspiro[4.5]decan-4-ol.
| Compound Name | formic acid;(4R,5R)-7-(6-methyl-2-morpholin-4-ylpyrimidin-4-yl)-7-azaspiro[4.5]decan-4-ol |
|---|---|
| PubChem CID | 154918505 |
| Molecular Formula | C19H30N4O4 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | formic acid;(4R,5R)-7-(6-methyl-2-morpholin-4-ylpyrimidin-4-yl)-7-azaspiro[4.5]decan-4-ol |
| SMILES | Cc1cc(N2CCC[C@]3(CCC[C@H]3O)C2)nc(N2CCOCC2)n1.O=CO |
| InChI | InChI=1S/C18H28N4O2.CH2O2/c1-14-12-16(20-17(19-14)21-8-10-24-11-9-21)22-7-3-6-18(13-22)5-2-4-15(18)23;2-1-3/h12,15,23H,2-11,13H2,1H3;1H,(H,2,3)/t15-,18-;/m1./s1 |
| InChIKey | NGWSXVHDVFWCJH-KQKCUOLZSA-N |
| XLogP | 1.45 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|