About formic acid;(4R,5S)-7-[4-(trifluoromethyl)-2-pyridinyl]-7-azaspiro[4.5]decan-4-ol
formic acid;(4R,5S)-7-[4-(trifluoromethyl)-2-pyridinyl]-7-azaspiro[4.5]decan-4-ol (PubChem CID 154915988) has the molecular formula C16H21F3N2O3
and a molecular weight of 346.35 g/mol. Its IUPAC name is formic acid;(4R,5S)-7-[4-(trifluoromethyl)-2-pyridinyl]-7-azaspiro[4.5]decan-4-ol.
Molecular Properties
| Compound Name | formic acid;(4R,5S)-7-[4-(trifluoromethyl)-2-pyridinyl]-7-azaspiro[4.5]decan-4-ol |
| PubChem CID | 154915988 |
| Molecular Formula | C16H21F3N2O3 |
| Molecular Weight | 346.35 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | formic acid;(4R,5S)-7-[4-(trifluoromethyl)-2-pyridinyl]-7-azaspiro[4.5]decan-4-ol |
| SMILES | O=CO.O[C@@H]1CCC[C@@]12CCCN(c1cc(C(F)(F)F)ccn1)C2 |
| InChI | InChI=1S/C15H19F3N2O.CH2O2/c16-15(17,18)11-4-7-19-13(9-11)20-8-2-6-14(10-20)5-1-3-12(14)21;2-1-3/h4,7,9,12,21H,1-3,5-6,8,10H2;1H,(H,2,3)/t12-,14+;/m1./s1 |
| InChIKey | LHMRXWLKIRATRK-OJMBIDBESA-N |
| XLogP | 2.93 |
| TPSA | 73.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.35 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze formic acid;(4R,5S)-7-[4-(trifluoromethyl)-2-pyridinyl]-7-azaspiro[4.5]decan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formic acid;(4R,5S)-7-[4-(trifluoromethyl)-2-pyridinyl]-7-azaspiro[4.5]decan-4-ol?
The IUPAC name of formic acid;(4R,5S)-7-[4-(trifluoromethyl)-2-pyridinyl]-7-azaspiro[4.5]decan-4-ol (CID 154915988) is formic acid;(4R,5S)-7-[4-(trifluoromethyl)-2-pyridinyl]-7-azaspiro[4.5]decan-4-ol.
What is the SMILES notation for formic acid;(4R,5S)-7-[4-(trifluoromethyl)-2-pyridinyl]-7-azaspiro[4.5]decan-4-ol?
The canonical SMILES for formic acid;(4R,5S)-7-[4-(trifluoromethyl)-2-pyridinyl]-7-azaspiro[4.5]decan-4-ol is O=CO.O[C@@H]1CCC[C@@]12CCCN(c1cc(C(F)(F)F)ccn1)C2.
What is the InChIKey of formic acid;(4R,5S)-7-[4-(trifluoromethyl)-2-pyridinyl]-7-azaspiro[4.5]decan-4-ol?
The InChIKey is LHMRXWLKIRATRK-OJMBIDBESA-N. The full InChI is InChI=1S/C15H19F3N2O.CH2O2/c16-15(17,18)11-4-7-19-13(9-11)20-8-2-6-14(10-20)5-1-3-12(14)21;2-1-3/h4,7,9,12,21H,1-3,5-6,8,10H2;1H,(H,2,3)/t12-,14+;/m1./s1.
What are the key properties of formic acid;(4R,5S)-7-[4-(trifluoromethyl)-2-pyridinyl]-7-azaspiro[4.5]decan-4-ol?
formic acid;(4R,5S)-7-[4-(trifluoromethyl)-2-pyridinyl]-7-azaspiro[4.5]decan-4-ol has a molecular weight of 346.35 g/mol, XLogP of 2.93, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for formic acid;(4R,5S)-7-[4-(trifluoromethyl)-2-pyridinyl]-7-azaspiro[4.5]decan-4-ol is sourced from PubChem (CID 154915988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).