C60H56N4Pt — CID 164703659
CID 164703659 (PubChem CID 164703659) has the molecular formula C60H56N4Pt and a molecular weight of 1028.21 g/mol.
| Compound Name | CID 164703659 |
|---|---|
| PubChem CID | 164703659 |
| Molecular Formula | C60H56N4Pt |
| Molecular Weight | 1028.21 g/mol |
| Exact Mass | 1027.42 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccc2c(c1)-c1cc(C(C)(C)C)ccc1C21c2[c-]c(ccc2)N2[CH-]N(C3=C2CCCC3)C2(c3ccccc3-c3ccccc32)N2[CH-]N(C3=C2CCCC3)c2[c-]c1ccc2.[Pt+4] |
| InChI | InChI=1S/C60H56N4.Pt/c1-57(2,3)39-29-31-49-47(35-39)48-36-40(58(4,5)6)30-32-50(48)59(49)41-17-15-19-43(33-41)61-37-63(55-27-13-11-25-53(55)61)60(51-23-9-7-21-45(51)46-22-8-10-24-52(46)60)64-38-62(44-20-16-18-42(59)34-44)54-26-12-14-28-56(54)64;/h7-10,15-24,29-32,35-38H,11-14,25-28H2,1-6H3;/q-4;+4 |
| InChIKey | AEMYWVVNHMCTMB-UHFFFAOYSA-N |
| XLogP | 14.19 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1028.21 |
| LogP ≤ 5 | 14.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|