C39H24N4OPt — CID 164703660
CID 164703660 (PubChem CID 164703660) has the molecular formula C39H24N4OPt and a molecular weight of 759.73 g/mol.
| Compound Name | CID 164703660 |
|---|---|
| PubChem CID | 164703660 |
| Molecular Formula | C39H24N4OPt |
| Molecular Weight | 759.73 g/mol |
| Exact Mass | 759.16 |
| IUPAC Name | — |
| SMILES | [Pt+4].[c-]1c2cccc1N1[CH-]N(c3ccccc31)C1(c3ccccc3-c3ccccc31)N1[CH-]N(c3[c-]c(ccc3)O2)c2ccccc21 |
| InChI | InChI=1S/C39H24N4O.Pt/c1-3-17-33-31(15-1)32-16-2-4-18-34(32)39(33)42-25-40(35-19-5-7-21-37(35)42)27-11-9-13-29(23-27)44-30-14-10-12-28(24-30)41-26-43(39)38-22-8-6-20-36(38)41;/h1-22,25-26H;/q-4;+4 |
| InChIKey | GMDXRQARDWKZAP-UHFFFAOYSA-N |
| XLogP | 9.13 |
| TPSA | 22.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.73 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|