C27H52OSi — CID 164705733
[(6R)-6-[(1R,3aS,4E,7aR)-7a-methyl-4-propylidene-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-methylheptan-2-yl]oxy-triethylsilane (PubChem CID 164705733) has the molecular formula C27H52OSi and a molecular weight of 420.80 g/mol. Its IUPAC name is [(6R)-6-[(1R,3aS,4E,7aR)-7a-methyl-4-propylidene-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-methylheptan-2-yl]oxy-triethylsilane.
| Compound Name | [(6R)-6-[(1R,3aS,4E,7aR)-7a-methyl-4-propylidene-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-methylheptan-2-yl]oxy-triethylsilane |
|---|---|
| PubChem CID | 164705733 |
| Molecular Formula | C27H52OSi |
| Molecular Weight | 420.80 g/mol |
| Exact Mass | 420.38 |
| IUPAC Name | [(6R)-6-[(1R,3aS,4E,7aR)-7a-methyl-4-propylidene-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-methylheptan-2-yl]oxy-triethylsilane |
| SMILES | CC/C=C1\CCC[C@]2(C)[C@@H]([C@H](C)CCCC(C)(C)O[Si](CC)(CC)CC)CC[C@@H]12 |
| InChI | InChI=1S/C27H52OSi/c1-9-15-23-17-14-21-27(8)24(18-19-25(23)27)22(5)16-13-20-26(6,7)28-29(10-2,11-3)12-4/h15,22,24-25H,9-14,16-21H2,1-8H3/b23-15+/t22-,24-,25+,27-/m1/s1 |
| InChIKey | VJXDSXUYSLMMEC-ZGCGPXOLSA-N |
| XLogP | 9.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.80 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|