C12H19NO2 — CID 164708105
1-[(2R)-1-[(2-methylpropan-2-yl)oxy]propan-2-yl]pyridin-2-one (PubChem CID 164708105) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is 1-[(2R)-1-[(2-methylpropan-2-yl)oxy]propan-2-yl]pyridin-2-one.
| Compound Name | 1-[(2R)-1-[(2-methylpropan-2-yl)oxy]propan-2-yl]pyridin-2-one |
|---|---|
| PubChem CID | 164708105 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | 1-[(2R)-1-[(2-methylpropan-2-yl)oxy]propan-2-yl]pyridin-2-one |
| SMILES | C[C@H](COC(C)(C)C)n1ccccc1=O |
| InChI | InChI=1S/C12H19NO2/c1-10(9-15-12(2,3)4)13-8-6-5-7-11(13)14/h5-8,10H,9H2,1-4H3/t10-/m1/s1 |
| InChIKey | QGEZTPNIAMGSOD-SNVBAGLBSA-N |
| XLogP | 2.22 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |