C11H15F3N2O2 — CID 153352786
ethane;4,4,4-trifluoro-2-(2-oxo-1-pyridinyl)butanamide (PubChem CID 153352786) has the molecular formula C11H15F3N2O2 and a molecular weight of 264.25 g/mol. Its IUPAC name is ethane;4,4,4-trifluoro-2-(2-oxo-1-pyridinyl)butanamide.
| Compound Name | ethane;4,4,4-trifluoro-2-(2-oxo-1-pyridinyl)butanamide |
|---|---|
| PubChem CID | 153352786 |
| Molecular Formula | C11H15F3N2O2 |
| Molecular Weight | 264.25 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | ethane;4,4,4-trifluoro-2-(2-oxo-1-pyridinyl)butanamide |
| SMILES | CC.NC(=O)C(CC(F)(F)F)n1ccccc1=O |
| InChI | InChI=1S/C9H9F3N2O2.C2H6/c10-9(11,12)5-6(8(13)16)14-4-2-1-3-7(14)15;1-2/h1-4,6H,5H2,(H2,13,16);1-2H3 |
| InChIKey | PUNMTBGDWKIAHH-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 65.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.25 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |