C29H42O7 — CID 164709221
1-O-(1-ethylcyclopentyl) 5-O-(2-oxooxolan-3-yl) 2-[2-(4-hydroxyphenyl)butyl]-2,4,4-trimethylpentanedioate (PubChem CID 164709221) has the molecular formula C29H42O7 and a molecular weight of 502.65 g/mol. Its IUPAC name is 1-O-(1-ethylcyclopentyl) 5-O-(2-oxooxolan-3-yl) 2-[2-(4-hydroxyphenyl)butyl]-2,4,4-trimethylpentanedioate.
| Compound Name | 1-O-(1-ethylcyclopentyl) 5-O-(2-oxooxolan-3-yl) 2-[2-(4-hydroxyphenyl)butyl]-2,4,4-trimethylpentanedioate |
|---|---|
| PubChem CID | 164709221 |
| Molecular Formula | C29H42O7 |
| Molecular Weight | 502.65 g/mol |
| Exact Mass | 502.29 |
| IUPAC Name | 1-O-(1-ethylcyclopentyl) 5-O-(2-oxooxolan-3-yl) 2-[2-(4-hydroxyphenyl)butyl]-2,4,4-trimethylpentanedioate |
| SMILES | CCC(CC(C)(CC(C)(C)C(=O)OC1CCOC1=O)C(=O)OC1(CC)CCCC1)c1ccc(O)cc1 |
| InChI | InChI=1S/C29H42O7/c1-6-20(21-10-12-22(30)13-11-21)18-28(5,26(33)36-29(7-2)15-8-9-16-29)19-27(3,4)25(32)35-23-14-17-34-24(23)31/h10-13,20,23,30H,6-9,14-19H2,1-5H3 |
| InChIKey | VWQKMXUVFPTEMH-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.65 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|