C37H53F9O10 — CID 163831756
5-O-(1-ethylcyclopentyl) 1-O-[3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-5-(1,1,1-trifluoro-2-hydroxypropan-2-yl)cyclohexyl] 3-O-(2-oxooxolan-3-yl) 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate (PubChem CID 163831756) has the molecular formula C37H53F9O10 and a molecular weight of 828.80 g/mol. Its IUPAC name is 5-O-(1-ethylcyclopentyl) 1-O-[3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-5-(1,1,1-trifluoro-2-hydroxypropan-2-yl)cyclohexyl] 3-O-(2-oxooxolan-3-yl) 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate.
| Compound Name | 5-O-(1-ethylcyclopentyl) 1-O-[3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-5-(1,1,1-trifluoro-2-hydroxypropan-2-yl)cyclohexyl] 3-O-(2-oxooxolan-3-yl) 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 163831756 |
| Molecular Formula | C37H53F9O10 |
| Molecular Weight | 828.80 g/mol |
| Exact Mass | 828.35 |
| IUPAC Name | 5-O-(1-ethylcyclopentyl) 1-O-[3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-5-(1,1,1-trifluoro-2-hydroxypropan-2-yl)cyclohexyl] 3-O-(2-oxooxolan-3-yl) 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate |
| SMILES | CCC1(OC(=O)C(C)(CC)CC(C)(CC(C)(C)C(=O)OC2CC(C(C)(O)C(F)(F)F)CC(C(O)(C(F)(F)F)C(F)(F)F)C2)C(=O)OC2CCOC2=O)CCCC1 |
| InChI | InChI=1S/C37H53F9O10/c1-8-30(5,28(50)56-33(9-2)13-10-11-14-33)20-31(6,27(49)55-24-12-15-53-25(24)47)19-29(3,4)26(48)54-23-17-21(32(7,51)35(38,39)40)16-22(18-23)34(52,36(41,42)43)37(44,45)46/h21-24,51-52H,8-20H2,1-7H3 |
| InChIKey | FQKFQAOYQKGCEF-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 828.80 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|