C41H64O9 — CID 165027270
2-O-(1-ethylcyclohexyl) 4-O-(3-ethyl-2-methylpentan-3-yl) 1-O-(2-oxooxolan-3-yl) 6-(4-hydroxyphenyl)-1,1,2,4-tetramethyloctane-1,2,4-tricarboxylate (PubChem CID 165027270) has the molecular formula C41H64O9 and a molecular weight of 700.95 g/mol. Its IUPAC name is 2-O-(1-ethylcyclohexyl) 4-O-(3-ethyl-2-methylpentan-3-yl) 1-O-(2-oxooxolan-3-yl) 6-(4-hydroxyphenyl)-1,1,2,4-tetramethyloctane-1,2,4-tricarboxylate.
| Compound Name | 2-O-(1-ethylcyclohexyl) 4-O-(3-ethyl-2-methylpentan-3-yl) 1-O-(2-oxooxolan-3-yl) 6-(4-hydroxyphenyl)-1,1,2,4-tetramethyloctane-1,2,4-tricarboxylate |
|---|---|
| PubChem CID | 165027270 |
| Molecular Formula | C41H64O9 |
| Molecular Weight | 700.95 g/mol |
| Exact Mass | 700.46 |
| IUPAC Name | 2-O-(1-ethylcyclohexyl) 4-O-(3-ethyl-2-methylpentan-3-yl) 1-O-(2-oxooxolan-3-yl) 6-(4-hydroxyphenyl)-1,1,2,4-tetramethyloctane-1,2,4-tricarboxylate |
| SMILES | CCC(CC(C)(CC(C)(C(=O)OC1(CC)CCCCC1)C(C)(C)C(=O)OC1CCOC1=O)C(=O)OC(CC)(CC)C(C)C)c1ccc(O)cc1 |
| InChI | InChI=1S/C41H64O9/c1-11-29(30-18-20-31(42)21-19-30)26-38(9,35(45)50-41(13-3,14-4)28(5)6)27-39(10,36(46)49-40(12-2)23-16-15-17-24-40)37(7,8)34(44)48-32-22-25-47-33(32)43/h18-21,28-29,32,42H,11-17,22-27H2,1-10H3 |
| InChIKey | PHHKQTDZDOXPSL-UHFFFAOYSA-N |
| XLogP | 8.98 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.95 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|