C20H30O2 — CID 164710698
(1S,5R,6R,7R,9R,10S,13R)-9-buta-1,3-dien-2-yl-7-hydroxy-6,10,13-trimethyltricyclo[4.4.3.01,5]tridecan-4-one (PubChem CID 164710698) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is (1S,5R,6R,7R,9R,10S,13R)-9-buta-1,3-dien-2-yl-7-hydroxy-6,10,13-trimethyltricyclo[4.4.3.01,5]tridecan-4-one.
| Compound Name | (1S,5R,6R,7R,9R,10S,13R)-9-buta-1,3-dien-2-yl-7-hydroxy-6,10,13-trimethyltricyclo[4.4.3.01,5]tridecan-4-one |
|---|---|
| PubChem CID | 164710698 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | (1S,5R,6R,7R,9R,10S,13R)-9-buta-1,3-dien-2-yl-7-hydroxy-6,10,13-trimethyltricyclo[4.4.3.01,5]tridecan-4-one |
| SMILES | C=CC(=C)[C@@H]1C[C@@H](O)[C@]2(C)[C@H](C)CC[C@]3(CCC(=O)[C@H]32)[C@H]1C |
| InChI | InChI=1S/C20H30O2/c1-6-12(2)15-11-17(22)19(5)13(3)7-9-20(14(15)4)10-8-16(21)18(19)20/h6,13-15,17-18,22H,1-2,7-11H2,3-5H3/t13-,14+,15+,17-,18+,19+,20+/m1/s1 |
| InChIKey | DHZXHCUVLWNDMX-IESDJGKPSA-N |
| XLogP | 4.15 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|