C26H20FNS — CID 164711682
2-(9-fluorodibenzothiophen-4-yl)-4-(2,4,6-trimethylphenyl)pyridine (PubChem CID 164711682) has the molecular formula C26H20FNS and a molecular weight of 397.52 g/mol. Its IUPAC name is 2-(9-fluorodibenzothiophen-4-yl)-4-(2,4,6-trimethylphenyl)pyridine.
| Compound Name | 2-(9-fluorodibenzothiophen-4-yl)-4-(2,4,6-trimethylphenyl)pyridine |
|---|---|
| PubChem CID | 164711682 |
| Molecular Formula | C26H20FNS |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | 2-(9-fluorodibenzothiophen-4-yl)-4-(2,4,6-trimethylphenyl)pyridine |
| SMILES | Cc1cc(C)c(-c2ccnc(-c3cccc4c3sc3cccc(F)c34)c2)c(C)c1 |
| InChI | InChI=1S/C26H20FNS/c1-15-12-16(2)24(17(3)13-15)18-10-11-28-22(14-18)19-6-4-7-20-25-21(27)8-5-9-23(25)29-26(19)20/h4-14H,1-3H3 |
| InChIKey | YEZYWUMXGFQSEL-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |