C27H25BrClO2P — CID 164719987
(4-bromo-2,6-dimethoxyphenyl)methyl-chloro-triphenyl-λ5-phosphane (PubChem CID 164719987) has the molecular formula C27H25BrClO2P and a molecular weight of 527.83 g/mol. Its IUPAC name is (4-bromo-2,6-dimethoxyphenyl)methyl-chloro-triphenyl-λ5-phosphane.
| Compound Name | (4-bromo-2,6-dimethoxyphenyl)methyl-chloro-triphenyl-λ5-phosphane |
|---|---|
| PubChem CID | 164719987 |
| Molecular Formula | C27H25BrClO2P |
| Molecular Weight | 527.83 g/mol |
| Exact Mass | 526.05 |
| IUPAC Name | (4-bromo-2,6-dimethoxyphenyl)methyl-chloro-triphenyl-λ5-phosphane |
| SMILES | COc1cc(Br)cc(OC)c1CP(Cl)(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H25BrClO2P/c1-30-26-18-21(28)19-27(31-2)25(26)20-32(29,22-12-6-3-7-13-22,23-14-8-4-9-15-23)24-16-10-5-11-17-24/h3-19H,20H2,1-2H3 |
| InChIKey | MNSRXUJPUUXNNR-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.83 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|