C32H30BrF2O2P — CID 145168811
1-[4-[(4-bromo-2,6-difluoro-3,5-dimethoxyphenyl)methyl]phenyl]-1,1-diphenyl-3,4-dihydro-2H-1λ5-phosphinine (PubChem CID 145168811) has the molecular formula C32H30BrF2O2P and a molecular weight of 595.46 g/mol. Its IUPAC name is 1-[4-[(4-bromo-2,6-difluoro-3,5-dimethoxyphenyl)methyl]phenyl]-1,1-diphenyl-3,4-dihydro-2H-1λ5-phosphinine.
| Compound Name | 1-[4-[(4-bromo-2,6-difluoro-3,5-dimethoxyphenyl)methyl]phenyl]-1,1-diphenyl-3,4-dihydro-2H-1λ5-phosphinine |
|---|---|
| PubChem CID | 145168811 |
| Molecular Formula | C32H30BrF2O2P |
| Molecular Weight | 595.46 g/mol |
| Exact Mass | 594.11 |
| IUPAC Name | 1-[4-[(4-bromo-2,6-difluoro-3,5-dimethoxyphenyl)methyl]phenyl]-1,1-diphenyl-3,4-dihydro-2H-1λ5-phosphinine |
| SMILES | COc1c(F)c(Cc2ccc(P3(c4ccccc4)(c4ccccc4)C=CCCC3)cc2)c(F)c(OC)c1Br |
| InChI | InChI=1S/C32H30BrF2O2P/c1-36-31-28(33)32(37-2)30(35)27(29(31)34)22-23-16-18-26(19-17-23)38(20-10-5-11-21-38,24-12-6-3-7-13-24)25-14-8-4-9-15-25/h3-4,6-10,12-20H,5,11,21-22H2,1-2H3 |
| InChIKey | FSGUIXIGUOMPAM-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.46 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|