C26H33N7O4 — CID 164725221
N-[5-[2-(2-aminoethoxy)ethoxy]pentyl]-4-[5-(furan-2-ylmethylamino)-[1,2,4]triazolo[4,3-c]pyrimidin-8-yl]benzamide (PubChem CID 164725221) has the molecular formula C26H33N7O4 and a molecular weight of 507.60 g/mol. Its IUPAC name is N-[5-[2-(2-aminoethoxy)ethoxy]pentyl]-4-[5-(furan-2-ylmethylamino)-[1,2,4]triazolo[4,3-c]pyrimidin-8-yl]benzamide.
| Compound Name | N-[5-[2-(2-aminoethoxy)ethoxy]pentyl]-4-[5-(furan-2-ylmethylamino)-[1,2,4]triazolo[4,3-c]pyrimidin-8-yl]benzamide |
|---|---|
| PubChem CID | 164725221 |
| Molecular Formula | C26H33N7O4 |
| Molecular Weight | 507.60 g/mol |
| Exact Mass | 507.26 |
| IUPAC Name | N-[5-[2-(2-aminoethoxy)ethoxy]pentyl]-4-[5-(furan-2-ylmethylamino)-[1,2,4]triazolo[4,3-c]pyrimidin-8-yl]benzamide |
| SMILES | NCCOCCOCCCCCNC(=O)c1ccc(-c2cnc(NCc3ccco3)n3cnnc23)cc1 |
| InChI | InChI=1S/C26H33N7O4/c27-10-14-36-16-15-35-12-3-1-2-11-28-25(34)21-8-6-20(7-9-21)23-18-30-26(33-19-31-32-24(23)33)29-17-22-5-4-13-37-22/h4-9,13,18-19H,1-3,10-12,14-17,27H2,(H,28,34)(H,29,30) |
| InChIKey | QRGBRECIAUERPF-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 141.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.60 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|