C22H30N6O3 — CID 166785524
tert-butyl N-[(E)-4-[5-(furan-2-ylmethylamino)-[1,2,4]triazolo[4,3-c]pyrimidin-8-yl]hept-4-enyl]carbamate (PubChem CID 166785524) has the molecular formula C22H30N6O3 and a molecular weight of 426.52 g/mol. Its IUPAC name is tert-butyl N-[(E)-4-[5-(furan-2-ylmethylamino)-[1,2,4]triazolo[4,3-c]pyrimidin-8-yl]hept-4-enyl]carbamate.
| Compound Name | tert-butyl N-[(E)-4-[5-(furan-2-ylmethylamino)-[1,2,4]triazolo[4,3-c]pyrimidin-8-yl]hept-4-enyl]carbamate |
|---|---|
| PubChem CID | 166785524 |
| Molecular Formula | C22H30N6O3 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | tert-butyl N-[(E)-4-[5-(furan-2-ylmethylamino)-[1,2,4]triazolo[4,3-c]pyrimidin-8-yl]hept-4-enyl]carbamate |
| SMILES | CC/C=C(\CCCNC(=O)OC(C)(C)C)c1cnc(NCc2ccco2)n2cnnc12 |
| InChI | InChI=1S/C22H30N6O3/c1-5-8-16(9-6-11-23-21(29)31-22(2,3)4)18-14-25-20(28-15-26-27-19(18)28)24-13-17-10-7-12-30-17/h7-8,10,12,14-15H,5-6,9,11,13H2,1-4H3,(H,23,29)(H,24,25)/b16-8+ |
| InChIKey | VQZCEIGCBZICBW-LZYBPNLTSA-N |
| XLogP | 4.43 |
| TPSA | 106.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|