C49H45N3OPt — CID 164727497
6-cyclohexyl-9-[3-(1',1',3',3'-tetramethyl-7-pyridin-2-ylspiro[3,6-dihydro-1H-inden-6-ide-2,2'-indene]-5-yl)oxybenzene-2-id-1-yl]pyrido[2,3-b]indole;platinum(2+) (PubChem CID 164727497) has the molecular formula C49H45N3OPt and a molecular weight of 887.00 g/mol. Its IUPAC name is 6-cyclohexyl-9-[3-(1',1',3',3'-tetramethyl-7-pyridin-2-ylspiro[3,6-dihydro-1H-inden-6-ide-2,2'-indene]-5-yl)oxybenzene-2-id-1-yl]pyrido[2,3-b]indole;platinum(2+).
| Compound Name | 6-cyclohexyl-9-[3-(1',1',3',3'-tetramethyl-7-pyridin-2-ylspiro[3,6-dihydro-1H-inden-6-ide-2,2'-indene]-5-yl)oxybenzene-2-id-1-yl]pyrido[2,3-b]indole;platinum(2+) |
|---|---|
| PubChem CID | 164727497 |
| Molecular Formula | C49H45N3OPt |
| Molecular Weight | 887.00 g/mol |
| Exact Mass | 886.32 |
| IUPAC Name | 6-cyclohexyl-9-[3-(1',1',3',3'-tetramethyl-7-pyridin-2-ylspiro[3,6-dihydro-1H-inden-6-ide-2,2'-indene]-5-yl)oxybenzene-2-id-1-yl]pyrido[2,3-b]indole;platinum(2+) |
| SMILES | CC1(C)c2ccccc2C(C)(C)C12Cc1cc(Oc3[c-]c(-n4c5ccc(C6CCCCC6)cc5c5cccnc54)ccc3)[c-]c(-c3ccccn3)c1C2.[Pt+2] |
| InChI | InChI=1S/C49H45N3O.Pt/c1-47(2)42-19-8-9-20-43(42)48(3,4)49(47)30-34-26-37(29-39(41(34)31-49)44-21-10-11-24-50-44)53-36-17-12-16-35(28-36)52-45-23-22-33(32-14-6-5-7-15-32)27-40(45)38-18-13-25-51-46(38)52;/h8-13,16-27,32H,5-7,14-15,30-31H2,1-4H3;/q-2;+2 |
| InChIKey | CBFPZXLWUPXTHX-UHFFFAOYSA-N |
| XLogP | 12.03 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 887.00 |
| LogP ≤ 5 | 12.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|