C48H37N3O2Pt — CID 164727521
CID 164727521 (PubChem CID 164727521) has the molecular formula C48H37N3O2Pt and a molecular weight of 882.92 g/mol.
| Compound Name | CID 164727521 |
|---|---|
| PubChem CID | 164727521 |
| Molecular Formula | C48H37N3O2Pt |
| Molecular Weight | 882.92 g/mol |
| Exact Mass | 882.25 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccccc1-c1cc(Oc2cccc(-c3[c-]ccc4c3oc3nc5c(cc34)CC3(Cc4ccccc4C3)C5)n2)nc(-c2[c-]cccc2)c1.[Pt+2] |
| InChI | InChI=1S/C48H37N3O2.Pt/c1-47(2,3)39-20-10-9-17-35(39)33-24-41(30-13-5-4-6-14-30)50-44(25-33)52-43-22-12-21-40(49-43)37-19-11-18-36-38-23-34-28-48(26-31-15-7-8-16-32(31)27-48)29-42(34)51-46(38)53-45(36)37;/h4-13,15-18,20-25H,26-29H2,1-3H3;/q-2;+2 |
| InChIKey | MFVQTVHXAXIJIS-UHFFFAOYSA-N |
| XLogP | 11.34 |
| TPSA | 61.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 882.92 |
| LogP ≤ 5 | 11.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|