C38H23IrN5O-2 — CID 177270732
CID 177270732 (PubChem CID 177270732) has the molecular formula C38H23IrN5O-2 and a molecular weight of 757.85 g/mol.
| Compound Name | CID 177270732 |
|---|---|
| PubChem CID | 177270732 |
| Molecular Formula | C38H23IrN5O-2 |
| Molecular Weight | 757.85 g/mol |
| Exact Mass | 758.15 |
| IUPAC Name | — |
| SMILES | [Ir].[c-]1ccc2c(oc3nc4c(ccc5ncn(-c6ccccc6)c54)cc32)c1-c1ccccn1.[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C27H15N4O.C11H8N.Ir/c1-2-7-18(8-3-1)31-16-29-23-13-12-17-15-21-19-9-6-10-20(22-11-4-5-14-28-22)26(19)32-27(21)30-24(17)25(23)31;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h1-9,11-16H;1-6,8-9H;/q2*-1; |
| InChIKey | LPCHRJJBGIFREF-UHFFFAOYSA-N |
| XLogP | 8.88 |
| TPSA | 69.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.85 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|