C53H38N3O2Pt- — CID 164727608
2-[6-[2-phenyl-1-(2-phenylphenyl)benzimidazol-4-yl]oxy-2-pyridinyl]-4-(2,2'-spirobi[1,3-dihydroindene]-5-yl)phenol;platinum (PubChem CID 164727608) has the molecular formula C53H38N3O2Pt- and a molecular weight of 943.98 g/mol. Its IUPAC name is 2-[6-[2-phenyl-1-(2-phenylphenyl)benzimidazol-4-yl]oxy-2-pyridinyl]-4-(2,2'-spirobi[1,3-dihydroindene]-5-yl)phenol;platinum.
| Compound Name | 2-[6-[2-phenyl-1-(2-phenylphenyl)benzimidazol-4-yl]oxy-2-pyridinyl]-4-(2,2'-spirobi[1,3-dihydroindene]-5-yl)phenol;platinum |
|---|---|
| PubChem CID | 164727608 |
| Molecular Formula | C53H38N3O2Pt- |
| Molecular Weight | 943.98 g/mol |
| Exact Mass | 943.26 |
| IUPAC Name | 2-[6-[2-phenyl-1-(2-phenylphenyl)benzimidazol-4-yl]oxy-2-pyridinyl]-4-(2,2'-spirobi[1,3-dihydroindene]-5-yl)phenol;platinum |
| SMILES | Oc1ccc(-c2ccc3c(c2)CC2(Cc4ccccc4C2)C3)cc1-c1cccc(Oc2cccc3c2nc(-c2[c-]cccc2)n3-c2ccccc2-c2ccccc2)n1.[Pt] |
| InChI | InChI=1S/C53H38N3O2.Pt/c57-48-28-27-38(37-25-26-41-33-53(34-42(41)29-37)31-39-17-7-8-18-40(39)32-53)30-44(48)45-20-11-24-50(54-45)58-49-23-12-22-47-51(49)55-52(36-15-5-2-6-16-36)56(47)46-21-10-9-19-43(46)35-13-3-1-4-14-35;/h1-15,17-30,57H,31-34H2;/q-1; |
| InChIKey | XZMAYYVICTUCEA-UHFFFAOYSA-N |
| XLogP | 12.27 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 943.98 |
| LogP ≤ 5 | 12.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|