C29H29ClN2O2S — CID 164730172
(R)-N-[(1S,2S)-2-(benzhydrylideneamino)-2-(2-chlorophenyl)-1-(furan-2-yl)ethyl]-2-methylpropane-2-sulfinamide (PubChem CID 164730172) has the molecular formula C29H29ClN2O2S and a molecular weight of 505.08 g/mol. Its IUPAC name is (R)-N-[(1S,2S)-2-(benzhydrylideneamino)-2-(2-chlorophenyl)-1-(furan-2-yl)ethyl]-2-methylpropane-2-sulfinamide.
| Compound Name | (R)-N-[(1S,2S)-2-(benzhydrylideneamino)-2-(2-chlorophenyl)-1-(furan-2-yl)ethyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 164730172 |
| Molecular Formula | C29H29ClN2O2S |
| Molecular Weight | 505.08 g/mol |
| Exact Mass | 504.16 |
| IUPAC Name | (R)-N-[(1S,2S)-2-(benzhydrylideneamino)-2-(2-chlorophenyl)-1-(furan-2-yl)ethyl]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)[S@@](=O)N[C@H](c1ccco1)[C@@H](N=C(c1ccccc1)c1ccccc1)c1ccccc1Cl |
| InChI | InChI=1S/C29H29ClN2O2S/c1-29(2,3)35(33)32-28(25-19-12-20-34-25)27(23-17-10-11-18-24(23)30)31-26(21-13-6-4-7-14-21)22-15-8-5-9-16-22/h4-20,27-28,32H,1-3H3/t27-,28+,35+/m0/s1 |
| InChIKey | CLZJHBVMKUIFGN-BNLPXROOSA-N |
| XLogP | 7.30 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.08 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|