C24H29F3N2O3S — CID 102144785
propyl (2S,3S)-2-(benzhydrylideneamino)-3-(tert-butylsulfinylamino)-4,4,4-trifluorobutanoate (PubChem CID 102144785) has the molecular formula C24H29F3N2O3S and a molecular weight of 482.57 g/mol. Its IUPAC name is propyl (2S,3S)-2-(benzhydrylideneamino)-3-(tert-butylsulfinylamino)-4,4,4-trifluorobutanoate.
| Compound Name | propyl (2S,3S)-2-(benzhydrylideneamino)-3-(tert-butylsulfinylamino)-4,4,4-trifluorobutanoate |
|---|---|
| PubChem CID | 102144785 |
| Molecular Formula | C24H29F3N2O3S |
| Molecular Weight | 482.57 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | propyl (2S,3S)-2-(benzhydrylideneamino)-3-(tert-butylsulfinylamino)-4,4,4-trifluorobutanoate |
| SMILES | CCCOC(=O)[C@@H](N=C(c1ccccc1)c1ccccc1)[C@H](NS(=O)C(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C24H29F3N2O3S/c1-5-16-32-22(30)20(21(24(25,26)27)29-33(31)23(2,3)4)28-19(17-12-8-6-9-13-17)18-14-10-7-11-15-18/h6-15,20-21,29H,5,16H2,1-4H3/t20-,21-,33?/m0/s1 |
| InChIKey | IDQDKCWBTJVTIU-ZCIWFQRQSA-N |
| XLogP | 4.83 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.57 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|