C31H42N4+2 — CID 164730515
1,4,5-trimethyl-3-[3-(3-methylimidazol-3-ium-1-yl)-5-[2,4,6-tri(propan-2-yl)phenyl]phenyl]imidazol-1-ium (PubChem CID 164730515) has the molecular formula C31H42N4+2 and a molecular weight of 470.71 g/mol. Its IUPAC name is 1,4,5-trimethyl-3-[3-(3-methylimidazol-3-ium-1-yl)-5-[2,4,6-tri(propan-2-yl)phenyl]phenyl]imidazol-1-ium.
| Compound Name | 1,4,5-trimethyl-3-[3-(3-methylimidazol-3-ium-1-yl)-5-[2,4,6-tri(propan-2-yl)phenyl]phenyl]imidazol-1-ium |
|---|---|
| PubChem CID | 164730515 |
| Molecular Formula | C31H42N4+2 |
| Molecular Weight | 470.71 g/mol |
| Exact Mass | 470.34 |
| IUPAC Name | 1,4,5-trimethyl-3-[3-(3-methylimidazol-3-ium-1-yl)-5-[2,4,6-tri(propan-2-yl)phenyl]phenyl]imidazol-1-ium |
| SMILES | Cc1c(C)[n+](C)cn1-c1cc(-c2c(C(C)C)cc(C(C)C)cc2C(C)C)cc(-n2cc[n+](C)c2)c1 |
| InChI | InChI=1S/C31H42N4/c1-20(2)25-15-29(21(3)4)31(30(16-25)22(5)6)26-13-27(34-12-11-32(9)18-34)17-28(14-26)35-19-33(10)23(7)24(35)8/h11-22H,1-10H3/q+2 |
| InChIKey | QYXQRXHKMWQNSO-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 17.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.71 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|