C31H45N2+ — CID 140932618
1-[3-tert-butyl-2-methyl-5-[2,4,6-tri(propan-2-yl)phenyl]phenyl]-2,3-dimethylimidazol-3-ium (PubChem CID 140932618) has the molecular formula C31H45N2+ and a molecular weight of 445.72 g/mol. Its IUPAC name is 1-[3-tert-butyl-2-methyl-5-[2,4,6-tri(propan-2-yl)phenyl]phenyl]-2,3-dimethylimidazol-3-ium.
| Compound Name | 1-[3-tert-butyl-2-methyl-5-[2,4,6-tri(propan-2-yl)phenyl]phenyl]-2,3-dimethylimidazol-3-ium |
|---|---|
| PubChem CID | 140932618 |
| Molecular Formula | C31H45N2+ |
| Molecular Weight | 445.72 g/mol |
| Exact Mass | 445.36 |
| IUPAC Name | 1-[3-tert-butyl-2-methyl-5-[2,4,6-tri(propan-2-yl)phenyl]phenyl]-2,3-dimethylimidazol-3-ium |
| SMILES | Cc1c(-n2cc[n+](C)c2C)cc(-c2c(C(C)C)cc(C(C)C)cc2C(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C31H45N2/c1-19(2)24-15-26(20(3)4)30(27(16-24)21(5)6)25-17-28(31(9,10)11)22(7)29(18-25)33-14-13-32(12)23(33)8/h13-21H,1-12H3/q+1 |
| InChIKey | ZLBBNUYWVCJOBY-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.72 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|