C22H24N4O4S2 — CID 164732214
[(Z)-butan-2-ylideneamino] N-[7-[[(Z)-butan-2-ylideneamino]oxycarbonylamino]thianthren-2-yl]carbamate (PubChem CID 164732214) has the molecular formula C22H24N4O4S2 and a molecular weight of 472.59 g/mol. Its IUPAC name is [(Z)-butan-2-ylideneamino] N-[7-[[(Z)-butan-2-ylideneamino]oxycarbonylamino]thianthren-2-yl]carbamate.
| Compound Name | [(Z)-butan-2-ylideneamino] N-[7-[[(Z)-butan-2-ylideneamino]oxycarbonylamino]thianthren-2-yl]carbamate |
|---|---|
| PubChem CID | 164732214 |
| Molecular Formula | C22H24N4O4S2 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.12 |
| IUPAC Name | [(Z)-butan-2-ylideneamino] N-[7-[[(Z)-butan-2-ylideneamino]oxycarbonylamino]thianthren-2-yl]carbamate |
| SMILES | CC/C(C)=N\OC(=O)Nc1ccc2c(c1)Sc1ccc(NC(=O)O/N=C(/C)CC)cc1S2 |
| InChI | InChI=1S/C22H24N4O4S2/c1-5-13(3)25-29-21(27)23-15-7-9-17-19(11-15)31-18-10-8-16(12-20(18)32-17)24-22(28)30-26-14(4)6-2/h7-12H,5-6H2,1-4H3,(H,23,27)(H,24,28)/b25-13-,26-14- |
| InChIKey | FINIAZNOVQDXAD-WFBNZKAHSA-N |
| XLogP | 6.97 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|