C34H38N4O4 — CID 164732363
(1S,4S,5S,6R,10R)-4-(aminomethyl)-N-(4-methoxyphenyl)-12,12-dimethyl-5-[4-(2-phenylethynyl)phenyl]-11,13-dioxa-3,8-diazatricyclo[8.3.0.03,6]tridecane-8-carboxamide (PubChem CID 164732363) has the molecular formula C34H38N4O4 and a molecular weight of 566.70 g/mol. Its IUPAC name is (1S,4S,5S,6R,10R)-4-(aminomethyl)-N-(4-methoxyphenyl)-12,12-dimethyl-5-[4-(2-phenylethynyl)phenyl]-11,13-dioxa-3,8-diazatricyclo[8.3.0.03,6]tridecane-8-carboxamide.
| Compound Name | (1S,4S,5S,6R,10R)-4-(aminomethyl)-N-(4-methoxyphenyl)-12,12-dimethyl-5-[4-(2-phenylethynyl)phenyl]-11,13-dioxa-3,8-diazatricyclo[8.3.0.03,6]tridecane-8-carboxamide |
|---|---|
| PubChem CID | 164732363 |
| Molecular Formula | C34H38N4O4 |
| Molecular Weight | 566.70 g/mol |
| Exact Mass | 566.29 |
| IUPAC Name | (1S,4S,5S,6R,10R)-4-(aminomethyl)-N-(4-methoxyphenyl)-12,12-dimethyl-5-[4-(2-phenylethynyl)phenyl]-11,13-dioxa-3,8-diazatricyclo[8.3.0.03,6]tridecane-8-carboxamide |
| SMILES | COc1ccc(NC(=O)N2C[C@H]3OC(C)(C)O[C@H]3CN3[C@H](CN)[C@H](c4ccc(C#Cc5ccccc5)cc4)[C@@H]3C2)cc1 |
| InChI | InChI=1S/C34H38N4O4/c1-34(2)41-30-21-37(33(39)36-26-15-17-27(40-3)18-16-26)20-29-32(28(19-35)38(29)22-31(30)42-34)25-13-11-24(12-14-25)10-9-23-7-5-4-6-8-23/h4-8,11-18,28-32H,19-22,35H2,1-3H3,(H,36,39)/t28-,29+,30-,31+,32+/m1/s1 |
| InChIKey | FNFYLSKDKAMHAK-OXFURMMHSA-N |
| XLogP | 4.26 |
| TPSA | 89.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.70 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|