C11H16O4 — CID 164735216
ethyl (E,3S)-4-formyl-3-(2-oxoethyl)hex-4-enoate (PubChem CID 164735216) has the molecular formula C11H16O4 and a molecular weight of 212.25 g/mol. Its IUPAC name is ethyl (E,3S)-4-formyl-3-(2-oxoethyl)hex-4-enoate.
| Compound Name | ethyl (E,3S)-4-formyl-3-(2-oxoethyl)hex-4-enoate |
|---|---|
| PubChem CID | 164735216 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | ethyl (E,3S)-4-formyl-3-(2-oxoethyl)hex-4-enoate |
| SMILES | C/C=C(/C=O)C(CC=O)CC(=O)OCC |
| InChI | InChI=1S/C11H16O4/c1-3-9(8-13)10(5-6-12)7-11(14)15-4-2/h3,6,8,10H,4-5,7H2,1-2H3/b9-3- |
| InChIKey | WKRGNNJAUDGCGD-OQFOIZHKSA-N |
| XLogP | 1.29 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|