C26H22N8O8 — CID 164735967
4-[[(Z)-2-[6-[1-(4-carboxy-3-hydroxyphenyl)triazol-4-yl]-4-(2-hydroxyethylcarbamoyl)-2-pyridinyl]-2-diazenylethenyl]amino]-2-hydroxybenzoic acid (PubChem CID 164735967) has the molecular formula C26H22N8O8 and a molecular weight of 574.51 g/mol. Its IUPAC name is 4-[[(Z)-2-[6-[1-(4-carboxy-3-hydroxyphenyl)triazol-4-yl]-4-(2-hydroxyethylcarbamoyl)-2-pyridinyl]-2-diazenylethenyl]amino]-2-hydroxybenzoic acid.
| Compound Name | 4-[[(Z)-2-[6-[1-(4-carboxy-3-hydroxyphenyl)triazol-4-yl]-4-(2-hydroxyethylcarbamoyl)-2-pyridinyl]-2-diazenylethenyl]amino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 164735967 |
| Molecular Formula | C26H22N8O8 |
| Molecular Weight | 574.51 g/mol |
| Exact Mass | 574.16 |
| IUPAC Name | 4-[[(Z)-2-[6-[1-(4-carboxy-3-hydroxyphenyl)triazol-4-yl]-4-(2-hydroxyethylcarbamoyl)-2-pyridinyl]-2-diazenylethenyl]amino]-2-hydroxybenzoic acid |
| SMILES | [H]/N=N/C(=C\Nc1ccc(C(=O)O)c(O)c1)c1cc(C(=O)NCCO)cc(-c2cn(-c3ccc(C(=O)O)c(O)c3)nn2)n1 |
| InChI | InChI=1S/C26H22N8O8/c27-31-20(11-29-14-1-3-16(25(39)40)22(36)9-14)18-7-13(24(38)28-5-6-35)8-19(30-18)21-12-34(33-32-21)15-2-4-17(26(41)42)23(37)10-15/h1-4,7-12,27,29,35-37H,5-6H2,(H,28,38)(H,39,40)(H,41,42)/b20-11-,31-27+ |
| InChIKey | AZNQAUTVUMXICI-LJOCFKMBSA-N |
| XLogP | 2.30 |
| TPSA | 256.23 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.51 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|