C26H22N8O7 — CID 164735996
4-[[(Z)-2-[6-[1-(4-carboxy-3-hydroxyphenyl)triazol-4-yl]-4-(ethylcarbamoyl)-2-pyridinyl]-2-diazenylethenyl]amino]-2-hydroxybenzoic acid (PubChem CID 164735996) has the molecular formula C26H22N8O7 and a molecular weight of 558.51 g/mol. Its IUPAC name is 4-[[(Z)-2-[6-[1-(4-carboxy-3-hydroxyphenyl)triazol-4-yl]-4-(ethylcarbamoyl)-2-pyridinyl]-2-diazenylethenyl]amino]-2-hydroxybenzoic acid.
| Compound Name | 4-[[(Z)-2-[6-[1-(4-carboxy-3-hydroxyphenyl)triazol-4-yl]-4-(ethylcarbamoyl)-2-pyridinyl]-2-diazenylethenyl]amino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 164735996 |
| Molecular Formula | C26H22N8O7 |
| Molecular Weight | 558.51 g/mol |
| Exact Mass | 558.16 |
| IUPAC Name | 4-[[(Z)-2-[6-[1-(4-carboxy-3-hydroxyphenyl)triazol-4-yl]-4-(ethylcarbamoyl)-2-pyridinyl]-2-diazenylethenyl]amino]-2-hydroxybenzoic acid |
| SMILES | [H]/N=N/C(=C\Nc1ccc(C(=O)O)c(O)c1)c1cc(C(=O)NCC)cc(-c2cn(-c3ccc(C(=O)O)c(O)c3)nn2)n1 |
| InChI | InChI=1S/C26H22N8O7/c1-2-28-24(37)13-7-18(20(31-27)11-29-14-3-5-16(25(38)39)22(35)9-14)30-19(8-13)21-12-34(33-32-21)15-4-6-17(26(40)41)23(36)10-15/h3-12,27,29,35-36H,2H2,1H3,(H,28,37)(H,38,39)(H,40,41)/b20-11-,31-27+ |
| InChIKey | UIEXDUQIOLSIOV-LJOCFKMBSA-N |
| XLogP | 3.33 |
| TPSA | 236.00 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.51 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|