C27H20N10O3 — CID 165025121
2-cyano-4-[4-[4-(ethylcarbamoyl)-6-[2-(3-isocyanophenyl)iminoethanehydrazonoyl]-2-pyridinyl]triazol-1-yl]benzoic acid (PubChem CID 165025121) has the molecular formula C27H20N10O3 and a molecular weight of 532.52 g/mol. Its IUPAC name is 2-cyano-4-[4-[4-(ethylcarbamoyl)-6-[2-(3-isocyanophenyl)iminoethanehydrazonoyl]-2-pyridinyl]triazol-1-yl]benzoic acid.
| Compound Name | 2-cyano-4-[4-[4-(ethylcarbamoyl)-6-[2-(3-isocyanophenyl)iminoethanehydrazonoyl]-2-pyridinyl]triazol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 165025121 |
| Molecular Formula | C27H20N10O3 |
| Molecular Weight | 532.52 g/mol |
| Exact Mass | 532.17 |
| IUPAC Name | 2-cyano-4-[4-[4-(ethylcarbamoyl)-6-[2-(3-isocyanophenyl)iminoethanehydrazonoyl]-2-pyridinyl]triazol-1-yl]benzoic acid |
| SMILES | [C-]#[N+]c1cccc(/N=C/C(=NN)c2cc(C(=O)NCC)cc(-c3cn(-c4ccc(C(=O)O)c(C#N)c4)nn3)n2)c1 |
| InChI | InChI=1S/C27H20N10O3/c1-3-31-26(38)16-10-22(24(34-29)14-32-19-6-4-5-18(12-19)30-2)33-23(11-16)25-15-37(36-35-25)20-7-8-21(27(39)40)17(9-20)13-28/h4-12,14-15H,3,29H2,1H3,(H,31,38)(H,39,40)/b32-14+,34-24? |
| InChIKey | FSMAMSGEVCPYJG-HCHJOKTDSA-N |
| XLogP | 3.26 |
| TPSA | 188.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.52 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|