C24H16F3N7O6 — CID 164735965
4-[[(2Z)-2-[6-[1-(4-carboxy-3-hydroxyphenyl)triazol-4-yl]-4-(trifluoromethyl)-2-pyridinyl]-2-hydrazinylideneethylidene]amino]-2-hydroxybenzoic acid (PubChem CID 164735965) has the molecular formula C24H16F3N7O6 and a molecular weight of 555.43 g/mol. Its IUPAC name is 4-[[(2Z)-2-[6-[1-(4-carboxy-3-hydroxyphenyl)triazol-4-yl]-4-(trifluoromethyl)-2-pyridinyl]-2-hydrazinylideneethylidene]amino]-2-hydroxybenzoic acid.
| Compound Name | 4-[[(2Z)-2-[6-[1-(4-carboxy-3-hydroxyphenyl)triazol-4-yl]-4-(trifluoromethyl)-2-pyridinyl]-2-hydrazinylideneethylidene]amino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 164735965 |
| Molecular Formula | C24H16F3N7O6 |
| Molecular Weight | 555.43 g/mol |
| Exact Mass | 555.11 |
| IUPAC Name | 4-[[(2Z)-2-[6-[1-(4-carboxy-3-hydroxyphenyl)triazol-4-yl]-4-(trifluoromethyl)-2-pyridinyl]-2-hydrazinylideneethylidene]amino]-2-hydroxybenzoic acid |
| SMILES | N/N=C(\C=N\c1ccc(C(=O)O)c(O)c1)c1cc(C(F)(F)F)cc(-c2cn(-c3ccc(C(=O)O)c(O)c3)nn2)n1 |
| InChI | InChI=1S/C24H16F3N7O6/c25-24(26,27)11-5-16(18(31-28)9-29-12-1-3-14(22(37)38)20(35)7-12)30-17(6-11)19-10-34(33-32-19)13-2-4-15(23(39)40)21(36)8-13/h1-10,35-36H,28H2,(H,37,38)(H,39,40)/b29-9+,31-18+ |
| InChIKey | UULFGSGQVNSYMM-AGOZHZAYSA-N |
| XLogP | 3.22 |
| TPSA | 209.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.43 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|