C24H20N6O3 — CID 165043744
4-[[2-hydrazinylidene-2-[3-[1-(4-methoxyphenyl)triazol-4-yl]phenyl]ethylidene]amino]benzoic acid (PubChem CID 165043744) has the molecular formula C24H20N6O3 and a molecular weight of 440.46 g/mol. Its IUPAC name is 4-[[2-hydrazinylidene-2-[3-[1-(4-methoxyphenyl)triazol-4-yl]phenyl]ethylidene]amino]benzoic acid.
| Compound Name | 4-[[2-hydrazinylidene-2-[3-[1-(4-methoxyphenyl)triazol-4-yl]phenyl]ethylidene]amino]benzoic acid |
|---|---|
| PubChem CID | 165043744 |
| Molecular Formula | C24H20N6O3 |
| Molecular Weight | 440.46 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | 4-[[2-hydrazinylidene-2-[3-[1-(4-methoxyphenyl)triazol-4-yl]phenyl]ethylidene]amino]benzoic acid |
| SMILES | COc1ccc(-n2cc(-c3cccc(C(/C=N/c4ccc(C(=O)O)cc4)=NN)c3)nn2)cc1 |
| InChI | InChI=1S/C24H20N6O3/c1-33-21-11-9-20(10-12-21)30-15-23(28-29-30)18-4-2-3-17(13-18)22(27-25)14-26-19-7-5-16(6-8-19)24(31)32/h2-15H,25H2,1H3,(H,31,32)/b26-14+,27-22? |
| InChIKey | FMMHVKRYNFHNGY-XHAGXDJYSA-N |
| XLogP | 3.71 |
| TPSA | 127.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.46 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|