C33H39IrN2- — CID 164738595
1-(2-hexyl-6-phenyl-4-propan-2-ylphenyl)-2-phenyl-5-propan-2-ylimidazole;iridium (PubChem CID 164738595) has the molecular formula C33H39IrN2- and a molecular weight of 655.91 g/mol. Its IUPAC name is 1-(2-hexyl-6-phenyl-4-propan-2-ylphenyl)-2-phenyl-5-propan-2-ylimidazole;iridium.
| Compound Name | 1-(2-hexyl-6-phenyl-4-propan-2-ylphenyl)-2-phenyl-5-propan-2-ylimidazole;iridium |
|---|---|
| PubChem CID | 164738595 |
| Molecular Formula | C33H39IrN2- |
| Molecular Weight | 655.91 g/mol |
| Exact Mass | 656.27 |
| IUPAC Name | 1-(2-hexyl-6-phenyl-4-propan-2-ylphenyl)-2-phenyl-5-propan-2-ylimidazole;iridium |
| SMILES | CCCCCCc1cc(C(C)C)cc(-c2ccccc2)c1-n1c(C(C)C)cnc1-c1[c-]cccc1.[Ir] |
| InChI | InChI=1S/C33H39N2.Ir/c1-6-7-8-11-20-28-21-29(24(2)3)22-30(26-16-12-9-13-17-26)32(28)35-31(25(4)5)23-34-33(35)27-18-14-10-15-19-27;/h9-10,12-18,21-25H,6-8,11,20H2,1-5H3;/q-1; |
| InChIKey | ITIGXAMALISRLR-UHFFFAOYSA-N |
| XLogP | 9.37 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.91 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|