C43H48N4O8 — CID 164739584
[3-[bis[(3-methoxyphenyl)methyl]carbamoyloxy]-5-[(2,2-dimethylhydrazinyl)methyl]phenyl] N,N-bis[(3-methoxyphenyl)methyl]carbamate (PubChem CID 164739584) has the molecular formula C43H48N4O8 and a molecular weight of 748.88 g/mol. Its IUPAC name is [3-[bis[(3-methoxyphenyl)methyl]carbamoyloxy]-5-[(2,2-dimethylhydrazinyl)methyl]phenyl] N,N-bis[(3-methoxyphenyl)methyl]carbamate.
| Compound Name | [3-[bis[(3-methoxyphenyl)methyl]carbamoyloxy]-5-[(2,2-dimethylhydrazinyl)methyl]phenyl] N,N-bis[(3-methoxyphenyl)methyl]carbamate |
|---|---|
| PubChem CID | 164739584 |
| Molecular Formula | C43H48N4O8 |
| Molecular Weight | 748.88 g/mol |
| Exact Mass | 748.35 |
| IUPAC Name | [3-[bis[(3-methoxyphenyl)methyl]carbamoyloxy]-5-[(2,2-dimethylhydrazinyl)methyl]phenyl] N,N-bis[(3-methoxyphenyl)methyl]carbamate |
| SMILES | COc1cccc(CN(Cc2cccc(OC)c2)C(=O)Oc2cc(CNN(C)C)cc(OC(=O)N(Cc3cccc(OC)c3)Cc3cccc(OC)c3)c2)c1 |
| InChI | InChI=1S/C43H48N4O8/c1-45(2)44-26-35-23-40(54-42(48)46(27-31-11-7-15-36(19-31)50-3)28-32-12-8-16-37(20-32)51-4)25-41(24-35)55-43(49)47(29-33-13-9-17-38(21-33)52-5)30-34-14-10-18-39(22-34)53-6/h7-25,44H,26-30H2,1-6H3 |
| InChIKey | IYSLOQRTVQZQGV-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 111.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.88 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|