C30H39N3O6 — CID 175706492
2-[2-[3-[(2,2-dimethylhydrazinyl)methyl]phenoxy]ethoxy]ethyl N,N-bis[(3-methoxyphenyl)methyl]carbamate (PubChem CID 175706492) has the molecular formula C30H39N3O6 and a molecular weight of 537.66 g/mol. Its IUPAC name is 2-[2-[3-[(2,2-dimethylhydrazinyl)methyl]phenoxy]ethoxy]ethyl N,N-bis[(3-methoxyphenyl)methyl]carbamate.
| Compound Name | 2-[2-[3-[(2,2-dimethylhydrazinyl)methyl]phenoxy]ethoxy]ethyl N,N-bis[(3-methoxyphenyl)methyl]carbamate |
|---|---|
| PubChem CID | 175706492 |
| Molecular Formula | C30H39N3O6 |
| Molecular Weight | 537.66 g/mol |
| Exact Mass | 537.28 |
| IUPAC Name | 2-[2-[3-[(2,2-dimethylhydrazinyl)methyl]phenoxy]ethoxy]ethyl N,N-bis[(3-methoxyphenyl)methyl]carbamate |
| SMILES | COc1cccc(CN(Cc2cccc(OC)c2)C(=O)OCCOCCOc2cccc(CNN(C)C)c2)c1 |
| InChI | InChI=1S/C30H39N3O6/c1-32(2)31-21-24-8-5-13-29(18-24)38-16-14-37-15-17-39-30(34)33(22-25-9-6-11-27(19-25)35-3)23-26-10-7-12-28(20-26)36-4/h5-13,18-20,31H,14-17,21-23H2,1-4H3 |
| InChIKey | MENHRGGBFKAXHF-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 81.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.66 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|