C24H34N2O4 — CID 21119889
2-(4-butoxyphenoxy)-N-[2-(dimethylamino)ethyl]-N-[(3-methoxyphenyl)methyl]acetamide (PubChem CID 21119889) has the molecular formula C24H34N2O4 and a molecular weight of 414.55 g/mol. Its IUPAC name is 2-(4-butoxyphenoxy)-N-[2-(dimethylamino)ethyl]-N-[(3-methoxyphenyl)methyl]acetamide.
| Compound Name | 2-(4-butoxyphenoxy)-N-[2-(dimethylamino)ethyl]-N-[(3-methoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 21119889 |
| Molecular Formula | C24H34N2O4 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.25 |
| IUPAC Name | 2-(4-butoxyphenoxy)-N-[2-(dimethylamino)ethyl]-N-[(3-methoxyphenyl)methyl]acetamide |
| SMILES | CCCCOc1ccc(OCC(=O)N(CCN(C)C)Cc2cccc(OC)c2)cc1 |
| InChI | InChI=1S/C24H34N2O4/c1-5-6-16-29-21-10-12-22(13-11-21)30-19-24(27)26(15-14-25(2)3)18-20-8-7-9-23(17-20)28-4/h7-13,17H,5-6,14-16,18-19H2,1-4H3 |
| InChIKey | TUXZFNUOOIWXFD-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|