C26H39ClN2O4 — CID 21119882
2-(4-butoxyphenoxy)-N-[2-(diethylamino)ethyl]-N-[(3-methoxyphenyl)methyl]acetamide;hydrochloride (PubChem CID 21119882) has the molecular formula C26H39ClN2O4 and a molecular weight of 479.06 g/mol. Its IUPAC name is 2-(4-butoxyphenoxy)-N-[2-(diethylamino)ethyl]-N-[(3-methoxyphenyl)methyl]acetamide;hydrochloride.
| Compound Name | 2-(4-butoxyphenoxy)-N-[2-(diethylamino)ethyl]-N-[(3-methoxyphenyl)methyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 21119882 |
| Molecular Formula | C26H39ClN2O4 |
| Molecular Weight | 479.06 g/mol |
| Exact Mass | 478.26 |
| IUPAC Name | 2-(4-butoxyphenoxy)-N-[2-(diethylamino)ethyl]-N-[(3-methoxyphenyl)methyl]acetamide;hydrochloride |
| SMILES | CCCCOc1ccc(OCC(=O)N(CCN(CC)CC)Cc2cccc(OC)c2)cc1.Cl |
| InChI | InChI=1S/C26H38N2O4.ClH/c1-5-8-18-31-23-12-14-24(15-13-23)32-21-26(29)28(17-16-27(6-2)7-3)20-22-10-9-11-25(19-22)30-4;/h9-15,19H,5-8,16-18,20-21H2,1-4H3;1H |
| InChIKey | ORFKXLJVUPIDOH-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.06 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|