C30H52N3O6P — CID 175900304
azane;3-[3-(3-decoxyphenyl)propanoyl-[(4-methoxyphenyl)methyl]amino]propylphosphonic acid (PubChem CID 175900304) has the molecular formula C30H52N3O6P and a molecular weight of 581.74 g/mol. Its IUPAC name is azane;3-[3-(3-decoxyphenyl)propanoyl-[(4-methoxyphenyl)methyl]amino]propylphosphonic acid.
| Compound Name | azane;3-[3-(3-decoxyphenyl)propanoyl-[(4-methoxyphenyl)methyl]amino]propylphosphonic acid |
|---|---|
| PubChem CID | 175900304 |
| Molecular Formula | C30H52N3O6P |
| Molecular Weight | 581.74 g/mol |
| Exact Mass | 581.36 |
| IUPAC Name | azane;3-[3-(3-decoxyphenyl)propanoyl-[(4-methoxyphenyl)methyl]amino]propylphosphonic acid |
| SMILES | CCCCCCCCCCOc1cccc(CCC(=O)N(CCCP(=O)(O)O)Cc2ccc(OC)cc2)c1.N.N |
| InChI | InChI=1S/C30H46NO6P.2H3N/c1-3-4-5-6-7-8-9-10-22-37-29-14-11-13-26(24-29)17-20-30(32)31(21-12-23-38(33,34)35)25-27-15-18-28(36-2)19-16-27;;/h11,13-16,18-19,24H,3-10,12,17,20-23,25H2,1-2H3,(H2,33,34,35);2*1H3 |
| InChIKey | KZDILOHRFOLZPK-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 166.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.74 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|