C31H39ClNO7P — CID 168720688
2-[5-[2-chloro-5-(4-phenylbutoxy)phenyl]pentanoyl-[(4-methoxyphenyl)methyl]amino]ethyl dihydrogen phosphate (PubChem CID 168720688) has the molecular formula C31H39ClNO7P and a molecular weight of 604.08 g/mol. Its IUPAC name is 2-[5-[2-chloro-5-(4-phenylbutoxy)phenyl]pentanoyl-[(4-methoxyphenyl)methyl]amino]ethyl dihydrogen phosphate.
| Compound Name | 2-[5-[2-chloro-5-(4-phenylbutoxy)phenyl]pentanoyl-[(4-methoxyphenyl)methyl]amino]ethyl dihydrogen phosphate |
|---|---|
| PubChem CID | 168720688 |
| Molecular Formula | C31H39ClNO7P |
| Molecular Weight | 604.08 g/mol |
| Exact Mass | 603.22 |
| IUPAC Name | 2-[5-[2-chloro-5-(4-phenylbutoxy)phenyl]pentanoyl-[(4-methoxyphenyl)methyl]amino]ethyl dihydrogen phosphate |
| SMILES | COc1ccc(CN(CCOP(=O)(O)O)C(=O)CCCCc2cc(OCCCCc3ccccc3)ccc2Cl)cc1 |
| InChI | InChI=1S/C31H39ClNO7P/c1-38-28-16-14-26(15-17-28)24-33(20-22-40-41(35,36)37)31(34)13-6-5-12-27-23-29(18-19-30(27)32)39-21-8-7-11-25-9-3-2-4-10-25/h2-4,9-10,14-19,23H,5-8,11-13,20-22,24H2,1H3,(H2,35,36,37) |
| InChIKey | VJMCNBLCSULKGP-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.08 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|